C26H32Cl2N2O3 — CID 90911582
4-chloro-N-[1-[4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-5-oxopentan-2-yl]benzamide (PubChem CID 90911582) has the molecular formula C26H32Cl2N2O3 and a molecular weight of 491.46 g/mol. Its IUPAC name is 4-chloro-N-[1-[4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-5-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-5-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 90911582 |
| Molecular Formula | C26H32Cl2N2O3 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4-chloro-N-[1-[4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methyl-5-oxopentan-2-yl]benzamide |
| SMILES | CC(CC=O)C(CN1CCC(O)(c2ccc(Cl)cc2)C(C)(C)C1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H32Cl2N2O3/c1-18(12-15-31)23(29-24(32)19-4-8-21(27)9-5-19)16-30-14-13-26(33,25(2,3)17-30)20-6-10-22(28)11-7-20/h4-11,15,18,23,33H,12-14,16-17H2,1-3H3,(H,29,32) |
| InChIKey | KVQFKPIMPMAOBB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|