C26H36ClN3O2S — CID 58457622
N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-2,3,6,7-tetrahydro-1,3-benzothiazole-2-carboxamide (PubChem CID 58457622) has the molecular formula C26H36ClN3O2S and a molecular weight of 490.11 g/mol. Its IUPAC name is N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-2,3,6,7-tetrahydro-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-2,3,6,7-tetrahydro-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 58457622 |
| Molecular Formula | C26H36ClN3O2S |
| Molecular Weight | 490.11 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-2,3,6,7-tetrahydro-1,3-benzothiazole-2-carboxamide |
| SMILES | CC(C)[C@H](CN1CC[C@](O)(c2ccc(Cl)cc2)C(C)(C)C1)NC(=O)C1NC2=C(CCC=C2)S1 |
| InChI | InChI=1S/C26H36ClN3O2S/c1-17(2)21(28-23(31)24-29-20-7-5-6-8-22(20)33-24)15-30-14-13-26(32,25(3,4)16-30)18-9-11-19(27)12-10-18/h5,7,9-12,17,21,24,29,32H,6,8,13-16H2,1-4H3,(H,28,31)/t21-,24?,26-/m0/s1 |
| InChIKey | XQGJLBOTZDSEFR-USOGPTGWSA-N |
| XLogP | 4.62 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.11 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |