C16H23N3O4 — CID 87603218
(2S)-2,6-diaminohexanoic acid;4H-quinolizine-2-carboxylic acid (PubChem CID 87603218) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;4H-quinolizine-2-carboxylic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;4H-quinolizine-2-carboxylic acid |
|---|---|
| PubChem CID | 87603218 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;4H-quinolizine-2-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)C1=CCN2C=CC=CC2=C1 |
| InChI | InChI=1S/C10H9NO2.C6H14N2O2/c12-10(13)8-4-6-11-5-2-1-3-9(11)7-8;7-4-2-1-3-5(8)6(9)10/h1-5,7H,6H2,(H,12,13);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | UEXWTLHUYJPICR-ZSCHJXSPSA-N |
| XLogP | 0.81 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|