C20H33ClN4O — CID 87603734
2-[6-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]piperidine-1-carbaldehyde;hydrochloride (PubChem CID 87603734) has the molecular formula C20H33ClN4O and a molecular weight of 380.96 g/mol. Its IUPAC name is 2-[6-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]piperidine-1-carbaldehyde;hydrochloride.
| Compound Name | 2-[6-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]piperidine-1-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 87603734 |
| Molecular Formula | C20H33ClN4O |
| Molecular Weight | 380.96 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[6-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]piperidine-1-carbaldehyde;hydrochloride |
| SMILES | CCC(CC)N1CCN(c2ccc(C3CCCCN3C=O)cn2)CC1.Cl |
| InChI | InChI=1S/C20H32N4O.ClH/c1-3-18(4-2)22-11-13-23(14-12-22)20-9-8-17(15-21-20)19-7-5-6-10-24(19)16-25;/h8-9,15-16,18-19H,3-7,10-14H2,1-2H3;1H |
| InChIKey | GZTSOAJEPDNMJJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|