C25H35N3O6S — CID 87605136
3,5-diethyl-2-methoxy-6-[[2-(3-morpholin-4-ylpropylamino)phenyl]sulfonylamino]benzoic acid (PubChem CID 87605136) has the molecular formula C25H35N3O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is 3,5-diethyl-2-methoxy-6-[[2-(3-morpholin-4-ylpropylamino)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 3,5-diethyl-2-methoxy-6-[[2-(3-morpholin-4-ylpropylamino)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 87605136 |
| Molecular Formula | C25H35N3O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3,5-diethyl-2-methoxy-6-[[2-(3-morpholin-4-ylpropylamino)phenyl]sulfonylamino]benzoic acid |
| SMILES | CCc1cc(CC)c(OC)c(C(=O)O)c1NS(=O)(=O)c1ccccc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C25H35N3O6S/c1-4-18-17-19(5-2)24(33-3)22(25(29)30)23(18)27-35(31,32)21-10-7-6-9-20(21)26-11-8-12-28-13-15-34-16-14-28/h6-7,9-10,17,26-27H,4-5,8,11-16H2,1-3H3,(H,29,30) |
| InChIKey | MCGMKQWALSPUGO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|