C24H25NO5S — CID 68862480
3-ethyl-2-methoxy-6-[[2-(2-phenylethyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 68862480) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is 3-ethyl-2-methoxy-6-[[2-(2-phenylethyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 3-ethyl-2-methoxy-6-[[2-(2-phenylethyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 68862480 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 3-ethyl-2-methoxy-6-[[2-(2-phenylethyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccccc2CCc2ccccc2)c(C(=O)O)c1OC |
| InChI | InChI=1S/C24H25NO5S/c1-3-18-15-16-20(22(24(26)27)23(18)30-2)25-31(28,29)21-12-8-7-11-19(21)14-13-17-9-5-4-6-10-17/h4-12,15-16,25H,3,13-14H2,1-2H3,(H,26,27) |
| InChIKey | XAJHDEYHOIUZMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |