C19H25N3O5S — CID 68864816
6-[[2-(3-aminopropylamino)phenyl]sulfonylamino]-3-ethyl-2-methoxybenzoic acid (PubChem CID 68864816) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 6-[[2-(3-aminopropylamino)phenyl]sulfonylamino]-3-ethyl-2-methoxybenzoic acid.
| Compound Name | 6-[[2-(3-aminopropylamino)phenyl]sulfonylamino]-3-ethyl-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 68864816 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-[[2-(3-aminopropylamino)phenyl]sulfonylamino]-3-ethyl-2-methoxybenzoic acid |
| SMILES | CCc1ccc(NS(=O)(=O)c2ccccc2NCCCN)c(C(=O)O)c1OC |
| InChI | InChI=1S/C19H25N3O5S/c1-3-13-9-10-15(17(19(23)24)18(13)27-2)22-28(25,26)16-8-5-4-7-14(16)21-12-6-11-20/h4-5,7-10,21-22H,3,6,11-12,20H2,1-2H3,(H,23,24) |
| InChIKey | UKAMRWUSKHNFQH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|