C12H18F6O2 — CID 87606544
(E)-1,1,1-trifluoro-2-(trifluoromethyl)undec-3-ene-2,10-diol (PubChem CID 87606544) has the molecular formula C12H18F6O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2-(trifluoromethyl)undec-3-ene-2,10-diol.
| Compound Name | (E)-1,1,1-trifluoro-2-(trifluoromethyl)undec-3-ene-2,10-diol |
|---|---|
| PubChem CID | 87606544 |
| Molecular Formula | C12H18F6O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (E)-1,1,1-trifluoro-2-(trifluoromethyl)undec-3-ene-2,10-diol |
| SMILES | CC(O)CCCCC/C=C/C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6O2/c1-9(19)7-5-3-2-4-6-8-10(20,11(13,14)15)12(16,17)18/h6,8-9,19-20H,2-5,7H2,1H3/b8-6+ |
| InChIKey | BEEMMWXVZBXPSV-SOFGYWHQSA-N |
| XLogP | 3.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|