C22H28FN5O3 — CID 87608841
N-[[(3R)-3-[[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl]piperidin-3-yl]methoxy]-N-methylformamide (PubChem CID 87608841) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[[(3R)-3-[[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl]piperidin-3-yl]methoxy]-N-methylformamide.
| Compound Name | N-[[(3R)-3-[[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl]piperidin-3-yl]methoxy]-N-methylformamide |
|---|---|
| PubChem CID | 87608841 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[[(3R)-3-[[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl]piperidin-3-yl]methoxy]-N-methylformamide |
| SMILES | Cc1ccc(NC(=O)Nc2cc(C[C@]3(CON(C)C=O)CCCNC3)ccc2F)cn1 |
| InChI | InChI=1S/C22H28FN5O3/c1-16-4-6-18(12-25-16)26-21(30)27-20-10-17(5-7-19(20)23)11-22(8-3-9-24-13-22)14-31-28(2)15-29/h4-7,10,12,15,24H,3,8-9,11,13-14H2,1-2H3,(H2,26,27,30)/t22-/m1/s1 |
| InChIKey | YIMXOCHKMOPKTN-JOCHJYFZSA-N |
| XLogP | 3.11 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|