C20H24FN5O3 — CID 87785503
[[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl-methylamino] (3S)-pyrrolidine-3-carboxylate (PubChem CID 87785503) has the molecular formula C20H24FN5O3 and a molecular weight of 401.44 g/mol. Its IUPAC name is [[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl-methylamino] (3S)-pyrrolidine-3-carboxylate.
| Compound Name | [[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl-methylamino] (3S)-pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 87785503 |
| Molecular Formula | C20H24FN5O3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | [[4-fluoro-3-[(6-methyl-3-pyridinyl)carbamoylamino]phenyl]methyl-methylamino] (3S)-pyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)Nc2cc(CN(C)OC(=O)[C@H]3CCNC3)ccc2F)cn1 |
| InChI | InChI=1S/C20H24FN5O3/c1-13-3-5-16(11-23-13)24-20(28)25-18-9-14(4-6-17(18)21)12-26(2)29-19(27)15-7-8-22-10-15/h3-6,9,11,15,22H,7-8,10,12H2,1-2H3,(H2,24,25,28)/t15-/m0/s1 |
| InChIKey | VABYDGCMIWJSPY-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|