C17H15ClN4O2 — CID 87609265
N-(7-chloro-3-oxo-2H-isoquinolin-6-yl)-2-(pyridin-2-ylmethylamino)acetamide (PubChem CID 87609265) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-(7-chloro-3-oxo-2H-isoquinolin-6-yl)-2-(pyridin-2-ylmethylamino)acetamide.
| Compound Name | N-(7-chloro-3-oxo-2H-isoquinolin-6-yl)-2-(pyridin-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 87609265 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(7-chloro-3-oxo-2H-isoquinolin-6-yl)-2-(pyridin-2-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccccn1)Nc1cc2cc(=O)[nH]cc2cc1Cl |
| InChI | InChI=1S/C17H15ClN4O2/c18-14-5-12-8-21-16(23)7-11(12)6-15(14)22-17(24)10-19-9-13-3-1-2-4-20-13/h1-8,19H,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | FXBHRNGIPOXSDN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |