About 4-(octylamino)butanoyl chloride;hydrochloride
4-(octylamino)butanoyl chloride;hydrochloride (PubChem CID 87609657) has the molecular formula C12H25Cl2NO
and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-(octylamino)butanoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 4-(octylamino)butanoyl chloride;hydrochloride |
| PubChem CID | 87609657 |
| Molecular Formula | C12H25Cl2NO |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-(octylamino)butanoyl chloride;hydrochloride |
| SMILES | CCCCCCCCNCCCC(=O)Cl.Cl |
| InChI | InChI=1S/C12H24ClNO.ClH/c1-2-3-4-5-6-7-10-14-11-8-9-12(13)15;/h14H,2-11H2,1H3;1H |
| InChIKey | HLAFGEMRCYZWOQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(octylamino)butanoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(octylamino)butanoyl chloride;hydrochloride?
The IUPAC name of 4-(octylamino)butanoyl chloride;hydrochloride (CID 87609657) is 4-(octylamino)butanoyl chloride;hydrochloride.
What is the SMILES notation for 4-(octylamino)butanoyl chloride;hydrochloride?
The canonical SMILES for 4-(octylamino)butanoyl chloride;hydrochloride is CCCCCCCCNCCCC(=O)Cl.Cl.
What is the InChIKey of 4-(octylamino)butanoyl chloride;hydrochloride?
The InChIKey is HLAFGEMRCYZWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24ClNO.ClH/c1-2-3-4-5-6-7-10-14-11-8-9-12(13)15;/h14H,2-11H2,1H3;1H.
What are the key properties of 4-(octylamino)butanoyl chloride;hydrochloride?
4-(octylamino)butanoyl chloride;hydrochloride has a molecular weight of 270.24 g/mol, XLogP of 3.90, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(octylamino)butanoyl chloride;hydrochloride is sourced from PubChem (CID 87609657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).