About methyl 4-(decylamino)butanoate;hydrochloride
methyl 4-(decylamino)butanoate;hydrochloride (PubChem CID 71755516) has the molecular formula C15H32ClNO2
and a molecular weight of 293.88 g/mol. Its IUPAC name is methyl 4-(decylamino)butanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-(decylamino)butanoate;hydrochloride |
| PubChem CID | 71755516 |
| Molecular Formula | C15H32ClNO2 |
| Molecular Weight | 293.88 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | methyl 4-(decylamino)butanoate;hydrochloride |
| SMILES | CCCCCCCCCCNCCCC(=O)OC.Cl |
| InChI | InChI=1S/C15H31NO2.ClH/c1-3-4-5-6-7-8-9-10-13-16-14-11-12-15(17)18-2;/h16H,3-14H2,1-2H3;1H |
| InChIKey | BOLSPSNCAUZANZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(decylamino)butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(decylamino)butanoate;hydrochloride?
The IUPAC name of methyl 4-(decylamino)butanoate;hydrochloride (CID 71755516) is methyl 4-(decylamino)butanoate;hydrochloride.
What is the SMILES notation for methyl 4-(decylamino)butanoate;hydrochloride?
The canonical SMILES for methyl 4-(decylamino)butanoate;hydrochloride is CCCCCCCCCCNCCCC(=O)OC.Cl.
What is the InChIKey of methyl 4-(decylamino)butanoate;hydrochloride?
The InChIKey is BOLSPSNCAUZANZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2.ClH/c1-3-4-5-6-7-8-9-10-13-16-14-11-12-15(17)18-2;/h16H,3-14H2,1-2H3;1H.
What are the key properties of methyl 4-(decylamino)butanoate;hydrochloride?
methyl 4-(decylamino)butanoate;hydrochloride has a molecular weight of 293.88 g/mol, XLogP of 4.09, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(decylamino)butanoate;hydrochloride is sourced from PubChem (CID 71755516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).