About methyl 4-(ethylamino)butanoate;dihydrochloride
methyl 4-(ethylamino)butanoate;dihydrochloride (PubChem CID 174870876) has the molecular formula C7H17Cl2NO2
and a molecular weight of 218.12 g/mol. Its IUPAC name is methyl 4-(ethylamino)butanoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 4-(ethylamino)butanoate;dihydrochloride |
| PubChem CID | 174870876 |
| Molecular Formula | C7H17Cl2NO2 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | methyl 4-(ethylamino)butanoate;dihydrochloride |
| SMILES | CCNCCCC(=O)OC.Cl.Cl |
| InChI | InChI=1S/C7H15NO2.2ClH/c1-3-8-6-4-5-7(9)10-2;;/h8H,3-6H2,1-2H3;2*1H |
| InChIKey | KVWQKVGKTLIHQZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(ethylamino)butanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(ethylamino)butanoate;dihydrochloride?
The IUPAC name of methyl 4-(ethylamino)butanoate;dihydrochloride (CID 174870876) is methyl 4-(ethylamino)butanoate;dihydrochloride.
What is the SMILES notation for methyl 4-(ethylamino)butanoate;dihydrochloride?
The canonical SMILES for methyl 4-(ethylamino)butanoate;dihydrochloride is CCNCCCC(=O)OC.Cl.Cl.
What is the InChIKey of methyl 4-(ethylamino)butanoate;dihydrochloride?
The InChIKey is KVWQKVGKTLIHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.2ClH/c1-3-8-6-4-5-7(9)10-2;;/h8H,3-6H2,1-2H3;2*1H.
What are the key properties of methyl 4-(ethylamino)butanoate;dihydrochloride?
methyl 4-(ethylamino)butanoate;dihydrochloride has a molecular weight of 218.12 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(ethylamino)butanoate;dihydrochloride is sourced from PubChem (CID 174870876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).