C32H32N2O2 — CID 87612860
[2-(2,2-diphenylethyl)-4-(3-methoxyphenyl)piperazin-1-yl]-phenylmethanone (PubChem CID 87612860) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is [2-(2,2-diphenylethyl)-4-(3-methoxyphenyl)piperazin-1-yl]-phenylmethanone.
| Compound Name | [2-(2,2-diphenylethyl)-4-(3-methoxyphenyl)piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 87612860 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | [2-(2,2-diphenylethyl)-4-(3-methoxyphenyl)piperazin-1-yl]-phenylmethanone |
| SMILES | COc1cccc(N2CCN(C(=O)c3ccccc3)C(CC(c3ccccc3)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C32H32N2O2/c1-36-30-19-11-18-28(22-30)33-20-21-34(32(35)27-16-9-4-10-17-27)29(24-33)23-31(25-12-5-2-6-13-25)26-14-7-3-8-15-26/h2-19,22,29,31H,20-21,23-24H2,1H3 |
| InChIKey | DMXXXHUWQFYZRB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |