C20H13ClF3NO6S — CID 87613481
6-(4-chloro-3-phenylmethoxyphenyl)-5-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid (PubChem CID 87613481) has the molecular formula C20H13ClF3NO6S and a molecular weight of 487.84 g/mol. Its IUPAC name is 6-(4-chloro-3-phenylmethoxyphenyl)-5-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid.
| Compound Name | 6-(4-chloro-3-phenylmethoxyphenyl)-5-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 87613481 |
| Molecular Formula | C20H13ClF3NO6S |
| Molecular Weight | 487.84 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 6-(4-chloro-3-phenylmethoxyphenyl)-5-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(OS(=O)(=O)C(F)(F)F)c(-c2ccc(Cl)c(OCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C20H13ClF3NO6S/c21-14-7-6-13(10-17(14)30-11-12-4-2-1-3-5-12)18-16(9-8-15(25-18)19(26)27)31-32(28,29)20(22,23)24/h1-10H,11H2,(H,26,27) |
| InChIKey | SKMRHULKPAGNCU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|