About 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium
1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium (PubChem CID 87615290) has the molecular formula C24H24Cl2Zr
and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium.
Molecular Properties
| Compound Name | 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium |
| PubChem CID | 87615290 |
| Molecular Formula | C24H24Cl2Zr |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium |
| SMILES | CCC(CC1(Cl)C(C)=Cc2ccccc21)C1(Cl)C(C)=Cc2ccccc21.[Zr] |
| InChI | InChI=1S/C24H24Cl2.Zr/c1-4-20(24(26)17(3)14-19-10-6-8-12-22(19)24)15-23(25)16(2)13-18-9-5-7-11-21(18)23;/h5-14,20H,4,15H2,1-3H3; |
| InChIKey | XTRCOKNUBOYXSX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium?
The IUPAC name of 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium (CID 87615290) is 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium.
What is the SMILES notation for 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium?
The canonical SMILES for 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium is CCC(CC1(Cl)C(C)=Cc2ccccc21)C1(Cl)C(C)=Cc2ccccc21.[Zr].
What is the InChIKey of 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium?
The InChIKey is XTRCOKNUBOYXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Cl2.Zr/c1-4-20(24(26)17(3)14-19-10-6-8-12-22(19)24)15-23(25)16(2)13-18-9-5-7-11-21(18)23;/h5-14,20H,4,15H2,1-3H3;.
What are the key properties of 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium?
1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium has a molecular weight of 474.59 g/mol, XLogP of 7.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-[1-(1-chloro-2-methylinden-1-yl)butan-2-yl]-2-methylindene;zirconium is sourced from PubChem (CID 87615290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).