C17H16ClF3N4O3 — CID 87616156
1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine (PubChem CID 87616156) has the molecular formula C17H16ClF3N4O3 and a molecular weight of 416.79 g/mol. Its IUPAC name is 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 87616156 |
| Molecular Formula | C17H16ClF3N4O3 |
| Molecular Weight | 416.79 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-[2-nitro-4-(trifluoromethyl)phenyl]piperazine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(Cc2ccc(Cl)[n+]([O-])c2)CC1 |
| InChI | InChI=1S/C17H16ClF3N4O3/c18-16-4-1-12(11-24(16)26)10-22-5-7-23(8-6-22)14-3-2-13(17(19,20)21)9-15(14)25(27)28/h1-4,9,11H,5-8,10H2 |
| InChIKey | SYZINCODTQBXFY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|