C26H42O9S — CID 87616471
1,4-dioxo-1,4-di(undec-2-enoyloxy)butane-2-sulfonic acid (PubChem CID 87616471) has the molecular formula C26H42O9S and a molecular weight of 530.68 g/mol. Its IUPAC name is 1,4-dioxo-1,4-di(undec-2-enoyloxy)butane-2-sulfonic acid.
| Compound Name | 1,4-dioxo-1,4-di(undec-2-enoyloxy)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 87616471 |
| Molecular Formula | C26H42O9S |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 1,4-dioxo-1,4-di(undec-2-enoyloxy)butane-2-sulfonic acid |
| SMILES | CCCCCCCCC=CC(=O)OC(=O)CC(C(=O)OC(=O)C=CCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C26H42O9S/c1-3-5-7-9-11-13-15-17-19-23(27)34-25(29)21-22(36(31,32)33)26(30)35-24(28)20-18-16-14-12-10-8-6-4-2/h17-20,22H,3-16,21H2,1-2H3,(H,31,32,33) |
| InChIKey | PQSAMNCMOOJQLN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|