About CID 87619272
CID 87619272 (PubChem CID 87619272) has the molecular formula C31H31AsF2N5O5S2
and a molecular weight of 730.67 g/mol.
Molecular Properties
| Compound Name | CID 87619272 |
| PubChem CID | 87619272 |
| Molecular Formula | C31H31AsF2N5O5S2 |
| Molecular Weight | 730.67 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | — |
| SMILES | Cc1nc(Oc2ccc(NS(C)(=O)=O)cc2)ccc1CN1CCC(N(C(=O)[As]c2cc(C(N)=O)c(F)cc2F)c2ccsc2)CC1 |
| InChI | InChI=1S/C31H31AsF2N5O5S2/c1-19-20(3-8-29(36-19)44-24-6-4-21(5-7-24)37-46(2,42)43)17-38-12-9-22(10-13-38)39(23-11-14-45-18-23)31(41)32-26-15-25(30(35)40)27(33)16-28(26)34/h3-8,11,14-16,18,22,37H,9-10,12-13,17H2,1-2H3,(H2,35,40) |
| InChIKey | LWETYXOUTMHDEG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 730.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87619272 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87619272?
The IUPAC name of CID 87619272 (CID 87619272) is not available.
What is the SMILES notation for CID 87619272?
The canonical SMILES for CID 87619272 is Cc1nc(Oc2ccc(NS(C)(=O)=O)cc2)ccc1CN1CCC(N(C(=O)[As]c2cc(C(N)=O)c(F)cc2F)c2ccsc2)CC1.
What is the InChIKey of CID 87619272?
The InChIKey is LWETYXOUTMHDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H31AsF2N5O5S2/c1-19-20(3-8-29(36-19)44-24-6-4-21(5-7-24)37-46(2,42)43)17-38-12-9-22(10-13-38)39(23-11-14-45-18-23)31(41)32-26-15-25(30(35)40)27(33)16-28(26)34/h3-8,11,14-16,18,22,37H,9-10,12-13,17H2,1-2H3,(H2,35,40).
What are the key properties of CID 87619272?
CID 87619272 has a molecular weight of 730.67 g/mol, XLogP of 4.61, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87619272 is sourced from PubChem (CID 87619272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).