C31H31AsF2N5O5S2 — CID 87619272
CID 87619272 (PubChem CID 87619272) has the molecular formula C31H31AsF2N5O5S2 and a molecular weight of 730.67 g/mol.
| Compound Name | CID 87619272 |
|---|---|
| PubChem CID | 87619272 |
| Molecular Formula | C31H31AsF2N5O5S2 |
| Molecular Weight | 730.67 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | — |
| SMILES | Cc1nc(Oc2ccc(NS(C)(=O)=O)cc2)ccc1CN1CCC(N(C(=O)[As]c2cc(C(N)=O)c(F)cc2F)c2ccsc2)CC1 |
| InChI | InChI=1S/C31H31AsF2N5O5S2/c1-19-20(3-8-29(36-19)44-24-6-4-21(5-7-24)37-46(2,42)43)17-38-12-9-22(10-13-38)39(23-11-14-45-18-23)31(41)32-26-15-25(30(35)40)27(33)16-28(26)34/h3-8,11,14-16,18,22,37H,9-10,12-13,17H2,1-2H3,(H2,35,40) |
| InChIKey | LWETYXOUTMHDEG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|