C28H27F3NO2+ — CID 87621556
5-(4-tert-butylphenyl)-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 87621556) has the molecular formula C28H27F3NO2+ and a molecular weight of 466.52 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 5-(4-tert-butylphenyl)-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 87621556 |
| Molecular Formula | C28H27F3NO2+ |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 5-(4-tert-butylphenyl)-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | CC(C)(C)c1ccc(C2=[N+](Cc3ccc(C(F)(F)F)cc3)CCc3cc4c(cc32)OCO4)cc1 |
| InChI | InChI=1S/C28H27F3NO2/c1-27(2,3)21-10-6-19(7-11-21)26-23-15-25-24(33-17-34-25)14-20(23)12-13-32(26)16-18-4-8-22(9-5-18)28(29,30)31/h4-11,14-15H,12-13,16-17H2,1-3H3/q+1 |
| InChIKey | HILIILBSSYSPGH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|