C25H29F3NO2+ — CID 87622411
5-heptyl-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium (PubChem CID 87622411) has the molecular formula C25H29F3NO2+ and a molecular weight of 432.51 g/mol. Its IUPAC name is 5-heptyl-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium.
| Compound Name | 5-heptyl-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
|---|---|
| PubChem CID | 87622411 |
| Molecular Formula | C25H29F3NO2+ |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 5-heptyl-6-[[4-(trifluoromethyl)phenyl]methyl]-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium |
| SMILES | CCCCCCCC1=[N+](Cc2ccc(C(F)(F)F)cc2)CCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C25H29F3NO2/c1-2-3-4-5-6-7-22-21-15-24-23(30-17-31-24)14-19(21)12-13-29(22)16-18-8-10-20(11-9-18)25(26,27)28/h8-11,14-15H,2-7,12-13,16-17H2,1H3/q+1 |
| InChIKey | OYBHWXUUYUNQGP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|