C6H9F3O2P+ — CID 87623279
but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 87623279) has the molecular formula C6H9F3O2P+ and a molecular weight of 201.10 g/mol. Its IUPAC name is but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium.
| Compound Name | but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
|---|---|
| PubChem CID | 87623279 |
| Molecular Formula | C6H9F3O2P+ |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | C=C(CC)[P+](=O)OCC(F)(F)F |
| InChI | InChI=1S/C6H9F3O2P/c1-3-5(2)12(10)11-4-6(7,8)9/h2-4H2,1H3/q+1 |
| InChIKey | ZLAZPMHKZBSWPQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|