About but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium
but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 87623279) has the molecular formula C6H9F3O2P+
and a molecular weight of 201.10 g/mol. Its IUPAC name is but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium.
Molecular Properties
| Compound Name | but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| PubChem CID | 87623279 |
| Molecular Formula | C6H9F3O2P+ |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | C=C(CC)[P+](=O)OCC(F)(F)F |
| InChI | InChI=1S/C6H9F3O2P/c1-3-5(2)12(10)11-4-6(7,8)9/h2-4H2,1H3/q+1 |
| InChIKey | ZLAZPMHKZBSWPQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The IUPAC name of but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium (CID 87623279) is but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium.
What is the SMILES notation for but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The canonical SMILES for but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium is C=C(CC)[P+](=O)OCC(F)(F)F.
What is the InChIKey of but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
The InChIKey is ZLAZPMHKZBSWPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O2P/c1-3-5(2)12(10)11-4-6(7,8)9/h2-4H2,1H3/q+1.
What are the key properties of but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium?
but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium has a molecular weight of 201.10 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-yl-oxo-(2,2,2-trifluoroethoxy)phosphanium is sourced from PubChem (CID 87623279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).