C5H5F5O4P+ — CID 130463731
methoxycarbonyl-oxo-(2,2,3,3,3-pentafluoropropoxy)phosphanium (PubChem CID 130463731) has the molecular formula C5H5F5O4P+ and a molecular weight of 255.05 g/mol. Its IUPAC name is methoxycarbonyl-oxo-(2,2,3,3,3-pentafluoropropoxy)phosphanium.
| Compound Name | methoxycarbonyl-oxo-(2,2,3,3,3-pentafluoropropoxy)phosphanium |
|---|---|
| PubChem CID | 130463731 |
| Molecular Formula | C5H5F5O4P+ |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | methoxycarbonyl-oxo-(2,2,3,3,3-pentafluoropropoxy)phosphanium |
| SMILES | COC(=O)[P+](=O)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H5F5O4P/c1-13-3(11)15(12)14-2-4(6,7)5(8,9)10/h2H2,1H3/q+1 |
| InChIKey | YMNJPYVLSUEEPO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|