C25H32N4O — CID 87626174
2-[4-[6-(9-cyclobutyl-3,9-diazaspiro[5.5]undecan-3-yl)pyridazin-3-yl]phenyl]acetaldehyde (PubChem CID 87626174) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[4-[6-(9-cyclobutyl-3,9-diazaspiro[5.5]undecan-3-yl)pyridazin-3-yl]phenyl]acetaldehyde.
| Compound Name | 2-[4-[6-(9-cyclobutyl-3,9-diazaspiro[5.5]undecan-3-yl)pyridazin-3-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87626174 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2-[4-[6-(9-cyclobutyl-3,9-diazaspiro[5.5]undecan-3-yl)pyridazin-3-yl]phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(-c2ccc(N3CCC4(CC3)CCN(C3CCC3)CC4)nn2)cc1 |
| InChI | InChI=1S/C25H32N4O/c30-19-10-20-4-6-21(7-5-20)23-8-9-24(27-26-23)29-17-13-25(14-18-29)11-15-28(16-12-25)22-2-1-3-22/h4-9,19,22H,1-3,10-18H2 |
| InChIKey | XSKXGBAQARSNBX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|