C31H40Br2N6O4 — CID 87633663
(1R)-1-[(4-amino-3,5-dibromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate (PubChem CID 87633663) has the molecular formula C31H40Br2N6O4 and a molecular weight of 720.51 g/mol. Its IUPAC name is (1R)-1-[(4-amino-3,5-dibromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate.
| Compound Name | (1R)-1-[(4-amino-3,5-dibromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87633663 |
| Molecular Formula | C31H40Br2N6O4 |
| Molecular Weight | 720.51 g/mol |
| Exact Mass | 718.15 |
| IUPAC Name | (1R)-1-[(4-amino-3,5-dibromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate |
| SMILES | CN(C)C1CCN(C2(CC=O)CC(N3CCc4ccccc4NC3=O)CC[N@+]2(Cc2cc(Br)c(N)c(Br)c2)C(=O)[O-])CC1 |
| InChI | InChI=1S/C31H40Br2N6O4/c1-36(2)23-8-12-37(13-9-23)31(11-16-40)19-24(38-14-7-22-5-3-4-6-27(22)35-29(38)41)10-15-39(31,30(42)43)20-21-17-25(32)28(34)26(33)18-21/h3-6,16-18,23-24H,7-15,19-20,34H2,1-2H3,(H-,35,41,42,43)/t24?,31?,39-/m0/s1 |
| InChIKey | BZQYVERSVKZCRS-ALTDDMDMSA-N |
| XLogP | 4.02 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|