C31H41BrN6O4 — CID 87635392
(1R)-1-[(4-amino-3-bromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate (PubChem CID 87635392) has the molecular formula C31H41BrN6O4 and a molecular weight of 641.61 g/mol. Its IUPAC name is (1R)-1-[(4-amino-3-bromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate.
| Compound Name | (1R)-1-[(4-amino-3-bromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87635392 |
| Molecular Formula | C31H41BrN6O4 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (1R)-1-[(4-amino-3-bromophenyl)methyl]-2-[4-(dimethylamino)piperidin-1-yl]-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidin-1-ium-1-carboxylate |
| SMILES | CN(C)C1CCN(C2(CC=O)CC(N3CCc4ccccc4NC3=O)CC[N@+]2(Cc2ccc(N)c(Br)c2)C(=O)[O-])CC1 |
| InChI | InChI=1S/C31H41BrN6O4/c1-35(2)24-10-14-36(15-11-24)31(13-18-39)20-25(37-16-9-23-5-3-4-6-28(23)34-29(37)40)12-17-38(31,30(41)42)21-22-7-8-27(33)26(32)19-22/h3-8,18-19,24-25H,9-17,20-21,33H2,1-2H3,(H-,34,40,41,42)/t25?,31?,38-/m0/s1 |
| InChIKey | GCNFUZDTWHYFLT-OJNFLDKRSA-N |
| XLogP | 3.26 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|