C13H15N3O2 — CID 87634311
N-[(Z)-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylprop-1-en-2-yl]formamide (PubChem CID 87634311) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[(Z)-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylprop-1-en-2-yl]formamide.
| Compound Name | N-[(Z)-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylprop-1-en-2-yl]formamide |
|---|---|
| PubChem CID | 87634311 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[(Z)-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylprop-1-en-2-yl]formamide |
| SMILES | O=CN/C(=C\c1ccncc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H15N3O2/c17-10-15-12(9-11-3-5-14-6-4-11)13(18)16-7-1-2-8-16/h3-6,9-10H,1-2,7-8H2,(H,15,17)/b12-9- |
| InChIKey | GXPOBBZDEFDXQV-XFXZXTDPSA-N |
| XLogP | 0.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|