C5H15N3S — CID 87634594
2-(2-aminoethylsulfanyl)propane-1,3-diamine (PubChem CID 87634594) has the molecular formula C5H15N3S and a molecular weight of 149.26 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)propane-1,3-diamine.
| Compound Name | 2-(2-aminoethylsulfanyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 87634594 |
| Molecular Formula | C5H15N3S |
| Molecular Weight | 149.26 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)propane-1,3-diamine |
| SMILES | NCCSC(CN)CN |
| InChI | InChI=1S/C5H15N3S/c6-1-2-9-5(3-7)4-8/h5H,1-4,6-8H2 |
| InChIKey | SJJKHXMREDKFIM-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |