C27H33ClN5O6+ — CID 87634771
tert-butyl 1-[(4-chlorophenyl)carbamoyl]-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]piperazin-1-ium-1-carboxylate (PubChem CID 87634771) has the molecular formula C27H33ClN5O6+ and a molecular weight of 559.04 g/mol. Its IUPAC name is tert-butyl 1-[(4-chlorophenyl)carbamoyl]-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]piperazin-1-ium-1-carboxylate.
| Compound Name | tert-butyl 1-[(4-chlorophenyl)carbamoyl]-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]piperazin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87634771 |
| Molecular Formula | C27H33ClN5O6+ |
| Molecular Weight | 559.04 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | tert-butyl 1-[(4-chlorophenyl)carbamoyl]-2-[[4-(3-oxomorpholin-4-yl)phenyl]carbamoyl]piperazin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C(=O)Nc2ccc(Cl)cc2)CCNCC1C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C27H32ClN5O6/c1-27(2,3)39-26(37)33(25(36)31-20-6-4-18(28)5-7-20)14-12-29-16-22(33)24(35)30-19-8-10-21(11-9-19)32-13-15-38-17-23(32)34/h4-11,22,29H,12-17H2,1-3H3,(H-,30,31,35,36)/p+1 |
| InChIKey | UPFZCUFDSSDCGG-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.04 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|