C22H25NO5 — CID 87636836
N-cyclopropyl-4-[(4-methoxyphenyl)methoxy]-2-[[(2R)-2-methyloxiran-2-yl]methoxy]benzamide (PubChem CID 87636836) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[(4-methoxyphenyl)methoxy]-2-[[(2R)-2-methyloxiran-2-yl]methoxy]benzamide.
| Compound Name | N-cyclopropyl-4-[(4-methoxyphenyl)methoxy]-2-[[(2R)-2-methyloxiran-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 87636836 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-cyclopropyl-4-[(4-methoxyphenyl)methoxy]-2-[[(2R)-2-methyloxiran-2-yl]methoxy]benzamide |
| SMILES | COc1ccc(COc2ccc(C(=O)NC3CC3)c(OC[C@@]3(C)CO3)c2)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-22(14-28-22)13-27-20-11-18(9-10-19(20)21(24)23-16-5-6-16)26-12-15-3-7-17(25-2)8-4-15/h3-4,7-11,16H,5-6,12-14H2,1-2H3,(H,23,24)/t22-/m0/s1 |
| InChIKey | DQPSZBSFLJYUSO-QFIPXVFZSA-N |
| XLogP | 3.33 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|