C23H29NO9 — CID 87637475
[3-[3-formyl-2-(2-methoxyethoxymethoxy)phenyl]-4-(2-methoxyethoxymethoxy)phenyl]methylcarbamic acid (PubChem CID 87637475) has the molecular formula C23H29NO9 and a molecular weight of 463.48 g/mol. Its IUPAC name is [3-[3-formyl-2-(2-methoxyethoxymethoxy)phenyl]-4-(2-methoxyethoxymethoxy)phenyl]methylcarbamic acid.
| Compound Name | [3-[3-formyl-2-(2-methoxyethoxymethoxy)phenyl]-4-(2-methoxyethoxymethoxy)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 87637475 |
| Molecular Formula | C23H29NO9 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [3-[3-formyl-2-(2-methoxyethoxymethoxy)phenyl]-4-(2-methoxyethoxymethoxy)phenyl]methylcarbamic acid |
| SMILES | COCCOCOc1ccc(CNC(=O)O)cc1-c1cccc(C=O)c1OCOCCOC |
| InChI | InChI=1S/C23H29NO9/c1-28-8-10-30-15-32-21-7-6-17(13-24-23(26)27)12-20(21)19-5-3-4-18(14-25)22(19)33-16-31-11-9-29-2/h3-7,12,14,24H,8-11,13,15-16H2,1-2H3,(H,26,27) |
| InChIKey | HNLSUMMYBXQQOJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|