About CID 87644957
CID 87644957 (PubChem CID 87644957) has the molecular formula C12H30AlN2
and a molecular weight of 229.37 g/mol.
Molecular Properties
| Compound Name | CID 87644957 |
| PubChem CID | 87644957 |
| Molecular Formula | C12H30AlN2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(N)CN.CC(C)[Al]C(C)C |
| InChI | InChI=1S/C6H16N2.2C3H7.Al/c1-6(2,3)5(8)4-7;2*1-3-2;/h5H,4,7-8H2,1-3H3;2*3H,1-2H3; |
| InChIKey | XXGVWTCGWGZVML-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 87644957 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87644957?
The IUPAC name of CID 87644957 (CID 87644957) is not available.
What is the SMILES notation for CID 87644957?
The canonical SMILES for CID 87644957 is CC(C)(C)C(N)CN.CC(C)[Al]C(C)C.
What is the InChIKey of CID 87644957?
The InChIKey is XXGVWTCGWGZVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.2C3H7.Al/c1-6(2,3)5(8)4-7;2*1-3-2;/h5H,4,7-8H2,1-3H3;2*3H,1-2H3;.
What are the key properties of CID 87644957?
CID 87644957 has a molecular weight of 229.37 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87644957 is sourced from PubChem (CID 87644957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).