C27H30ClN5O7S — CID 87645244
tert-butyl N-[3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypropyl]carbamate (PubChem CID 87645244) has the molecular formula C27H30ClN5O7S and a molecular weight of 604.09 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 87645244 |
| Molecular Formula | C27H30ClN5O7S |
| Molecular Weight | 604.09 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | tert-butyl N-[3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypropyl]carbamate |
| SMILES | CC1=CC=C(C(=O)Nc2cccnc2C(=O)Nc2ccc(Cl)cn2)C(OCCCNC(=O)OC(C)(C)C)C1=S(=O)=O |
| InChI | InChI=1S/C27H30ClN5O7S/c1-16-8-10-18(22(23(16)41(37)38)39-14-6-13-30-26(36)40-27(2,3)4)24(34)32-19-7-5-12-29-21(19)25(35)33-20-11-9-17(28)15-31-20/h5,7-12,15,22H,6,13-14H2,1-4H3,(H,30,36)(H,32,34)(H,31,33,35) |
| InChIKey | YVOJKYKMDSUFFK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.09 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|