C29H32ClN5O7S — CID 87645375
tert-butyl 3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypiperidine-1-carboxylate (PubChem CID 87645375) has the molecular formula C29H32ClN5O7S and a molecular weight of 630.12 g/mol. Its IUPAC name is tert-butyl 3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87645375 |
| Molecular Formula | C29H32ClN5O7S |
| Molecular Weight | 630.12 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | tert-butyl 3-[2-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-3-pyridinyl]carbamoyl]-5-methyl-6-sulfonylcyclohexa-2,4-dien-1-yl]oxypiperidine-1-carboxylate |
| SMILES | CC1=CC=C(C(=O)Nc2cccnc2C(=O)Nc2ccc(Cl)cn2)C(OC2CCCN(C(=O)OC(C)(C)C)C2)C1=S(=O)=O |
| InChI | InChI=1S/C29H32ClN5O7S/c1-17-9-11-20(24(25(17)43(39)40)41-19-7-6-14-35(16-19)28(38)42-29(2,3)4)26(36)33-21-8-5-13-31-23(21)27(37)34-22-12-10-18(30)15-32-22/h5,8-13,15,19,24H,6-7,14,16H2,1-4H3,(H,33,36)(H,32,34,37) |
| InChIKey | RBXWNVIWKMNTRP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.12 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|