C9H10ClFN2O — CID 87646855
3-chloro-1-ethyl-1-(4-fluorophenyl)urea (PubChem CID 87646855) has the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. Its IUPAC name is 3-chloro-1-ethyl-1-(4-fluorophenyl)urea.
| Compound Name | 3-chloro-1-ethyl-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 87646855 |
| Molecular Formula | C9H10ClFN2O |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-chloro-1-ethyl-1-(4-fluorophenyl)urea |
| SMILES | CCN(C(=O)NCl)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H10ClFN2O/c1-2-13(9(14)12-10)8-5-3-7(11)4-6-8/h3-6H,2H2,1H3,(H,12,14) |
| InChIKey | DFIMMSMPCWLKOM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|