C13H16FN3O4 — CID 107827403
(2R)-4-amino-2-[[ethyl-(4-fluorophenyl)carbamoyl]amino]-4-oxobutanoic acid (PubChem CID 107827403) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is (2R)-4-amino-2-[[ethyl-(4-fluorophenyl)carbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[ethyl-(4-fluorophenyl)carbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107827403 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R)-4-amino-2-[[ethyl-(4-fluorophenyl)carbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)N[C@H](CC(N)=O)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FN3O4/c1-2-17(9-5-3-8(14)4-6-9)13(21)16-10(12(19)20)7-11(15)18/h3-6,10H,2,7H2,1H3,(H2,15,18)(H,16,21)(H,19,20)/t10-/m1/s1 |
| InChIKey | PFZGQDXMPRASND-SNVBAGLBSA-N |
| XLogP | 0.69 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |