C11H20N4O4 — CID 87649718
N-(1,7,7-triformamidoheptyl)formamide (PubChem CID 87649718) has the molecular formula C11H20N4O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(1,7,7-triformamidoheptyl)formamide.
| Compound Name | N-(1,7,7-triformamidoheptyl)formamide |
|---|---|
| PubChem CID | 87649718 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(1,7,7-triformamidoheptyl)formamide |
| SMILES | O=CNC(CCCCCC(NC=O)NC=O)NC=O |
| InChI | InChI=1S/C11H20N4O4/c16-6-12-10(13-7-17)4-2-1-3-5-11(14-8-18)15-9-19/h6-11H,1-5H2,(H,12,16)(H,13,17)(H,14,18)(H,15,19) |
| InChIKey | CALBPWXKYGBQOZ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|