About N-octan-4-ylformamide
N-octan-4-ylformamide (PubChem CID 22178839) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is N-octan-4-ylformamide.
Molecular Properties
| Compound Name | N-octan-4-ylformamide |
| PubChem CID | 22178839 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N-octan-4-ylformamide |
| SMILES | CCCCC(CCC)NC=O |
| InChI | InChI=1S/C9H19NO/c1-3-5-7-9(6-4-2)10-8-11/h8-9H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | SBRXHADSXVESBT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-octan-4-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octan-4-ylformamide?
The IUPAC name of N-octan-4-ylformamide (CID 22178839) is N-octan-4-ylformamide.
What is the SMILES notation for N-octan-4-ylformamide?
The canonical SMILES for N-octan-4-ylformamide is CCCCC(CCC)NC=O.
What is the InChIKey of N-octan-4-ylformamide?
The InChIKey is SBRXHADSXVESBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-3-5-7-9(6-4-2)10-8-11/h8-9H,3-7H2,1-2H3,(H,10,11).
What are the key properties of N-octan-4-ylformamide?
N-octan-4-ylformamide has a molecular weight of 157.26 g/mol, XLogP of 2.09, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-octan-4-ylformamide is sourced from PubChem (CID 22178839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).