About S-(decan-5-ylamino) methanethioate
S-(decan-5-ylamino) methanethioate (PubChem CID 173065746) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is S-(decan-5-ylamino) methanethioate.
Molecular Properties
| Compound Name | S-(decan-5-ylamino) methanethioate |
| PubChem CID | 173065746 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | S-(decan-5-ylamino) methanethioate |
| SMILES | CCCCCC(CCCC)NSC=O |
| InChI | InChI=1S/C11H23NOS/c1-3-5-7-9-11(8-6-4-2)12-14-10-13/h10-12H,3-9H2,1-2H3 |
| InChIKey | JPQNKRNGUNXIMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(decan-5-ylamino) methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(decan-5-ylamino) methanethioate?
The IUPAC name of S-(decan-5-ylamino) methanethioate (CID 173065746) is S-(decan-5-ylamino) methanethioate.
What is the SMILES notation for S-(decan-5-ylamino) methanethioate?
The canonical SMILES for S-(decan-5-ylamino) methanethioate is CCCCCC(CCCC)NSC=O.
What is the InChIKey of S-(decan-5-ylamino) methanethioate?
The InChIKey is JPQNKRNGUNXIMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-3-5-7-9-11(8-6-4-2)12-14-10-13/h10-12H,3-9H2,1-2H3.
What are the key properties of S-(decan-5-ylamino) methanethioate?
S-(decan-5-ylamino) methanethioate has a molecular weight of 217.38 g/mol, XLogP of 3.55, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(decan-5-ylamino) methanethioate is sourced from PubChem (CID 173065746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).