C17H18N2O6S — CID 87649960
7-(dimethylamino)-3-(1-methylpyridin-1-ium-4-yl)chromen-2-one;hydrogen sulfate (PubChem CID 87649960) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 7-(dimethylamino)-3-(1-methylpyridin-1-ium-4-yl)chromen-2-one;hydrogen sulfate.
| Compound Name | 7-(dimethylamino)-3-(1-methylpyridin-1-ium-4-yl)chromen-2-one;hydrogen sulfate |
|---|---|
| PubChem CID | 87649960 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 7-(dimethylamino)-3-(1-methylpyridin-1-ium-4-yl)chromen-2-one;hydrogen sulfate |
| SMILES | CN(C)c1ccc2cc(-c3cc[n+](C)cc3)c(=O)oc2c1.O=S(=O)([O-])O |
| InChI | InChI=1S/C17H17N2O2.H2O4S/c1-18(2)14-5-4-13-10-15(17(20)21-16(13)11-14)12-6-8-19(3)9-7-12;1-5(2,3)4/h4-11H,1-3H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | HPTGVBRZAJKRPV-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|