C29H25N5O5 — CID 87651146
4-[[3-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]-N-formylanilino]methyl]benzoic acid (PubChem CID 87651146) has the molecular formula C29H25N5O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is 4-[[3-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]-N-formylanilino]methyl]benzoic acid.
| Compound Name | 4-[[3-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]-N-formylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 87651146 |
| Molecular Formula | C29H25N5O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-[[3-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]-N-formylanilino]methyl]benzoic acid |
| SMILES | COc1ccc(Nc2nc(-c3cccc(N(C=O)Cc4ccc(C(=O)O)cc4)c3)cn3ccnc23)cc1OC |
| InChI | InChI=1S/C29H25N5O5/c1-38-25-11-10-22(15-26(25)39-2)31-27-28-30-12-13-33(28)17-24(32-27)21-4-3-5-23(14-21)34(18-35)16-19-6-8-20(9-7-19)29(36)37/h3-15,17-18H,16H2,1-2H3,(H,31,32)(H,36,37) |
| InChIKey | WVEWTDZEWJICGZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|