C23H23N5O3 — CID 91526165
4-[2-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]ethyl]benzamide (PubChem CID 91526165) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-[2-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]ethyl]benzamide.
| Compound Name | 4-[2-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 91526165 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 4-[2-[8-(3,4-dimethoxyanilino)imidazo[1,2-a]pyrazin-6-yl]ethyl]benzamide |
| SMILES | COc1ccc(Nc2nc(CCc3ccc(C(N)=O)cc3)cn3ccnc23)cc1OC |
| InChI | InChI=1S/C23H23N5O3/c1-30-19-10-9-17(13-20(19)31-2)26-22-23-25-11-12-28(23)14-18(27-22)8-5-15-3-6-16(7-4-15)21(24)29/h3-4,6-7,9-14H,5,8H2,1-2H3,(H2,24,29)(H,26,27) |
| InChIKey | SOSFQNSQNHXLLR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |