C17H20ClN3O — CID 87651338
1-(5-chloropentyl)imidazo[4,5-c]quinoline;oxirane (PubChem CID 87651338) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is 1-(5-chloropentyl)imidazo[4,5-c]quinoline;oxirane.
| Compound Name | 1-(5-chloropentyl)imidazo[4,5-c]quinoline;oxirane |
|---|---|
| PubChem CID | 87651338 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-(5-chloropentyl)imidazo[4,5-c]quinoline;oxirane |
| SMILES | C1CO1.ClCCCCCn1cnc2cnc3ccccc3c21 |
| InChI | InChI=1S/C15H16ClN3.C2H4O/c16-8-4-1-5-9-19-11-18-14-10-17-13-7-3-2-6-12(13)15(14)19;1-2-3-1/h2-3,6-7,10-11H,1,4-5,8-9H2;1-2H2 |
| InChIKey | RGEYPBMZFXBYDS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|