C15H15Cl2NOS — CID 87654888
2,4-dichloro-3-methyl-6-[(4-methylsulfanylphenyl)methylamino]phenol (PubChem CID 87654888) has the molecular formula C15H15Cl2NOS and a molecular weight of 328.26 g/mol. Its IUPAC name is 2,4-dichloro-3-methyl-6-[(4-methylsulfanylphenyl)methylamino]phenol.
| Compound Name | 2,4-dichloro-3-methyl-6-[(4-methylsulfanylphenyl)methylamino]phenol |
|---|---|
| PubChem CID | 87654888 |
| Molecular Formula | C15H15Cl2NOS |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2,4-dichloro-3-methyl-6-[(4-methylsulfanylphenyl)methylamino]phenol |
| SMILES | CSc1ccc(CNc2cc(Cl)c(C)c(Cl)c2O)cc1 |
| InChI | InChI=1S/C15H15Cl2NOS/c1-9-12(16)7-13(15(19)14(9)17)18-8-10-3-5-11(20-2)6-4-10/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | ZXZJUZFKPODELN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|