C23H19FN4O — CID 87657013
2-[4-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)-3-fluorophenyl]benzaldehyde (PubChem CID 87657013) has the molecular formula C23H19FN4O and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[4-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)-3-fluorophenyl]benzaldehyde.
| Compound Name | 2-[4-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)-3-fluorophenyl]benzaldehyde |
|---|---|
| PubChem CID | 87657013 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-[4-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)-3-fluorophenyl]benzaldehyde |
| SMILES | Nc1nccn2c(C3CCC3)nc(-c3ccc(-c4ccccc4C=O)cc3F)c12 |
| InChI | InChI=1S/C23H19FN4O/c24-19-12-15(17-7-2-1-4-16(17)13-29)8-9-18(19)20-21-22(25)26-10-11-28(21)23(27-20)14-5-3-6-14/h1-2,4,7-14H,3,5-6H2,(H2,25,26) |
| InChIKey | FEZCWYLKLSKGGG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|