About lithium;azane;bis(trimethylsilyl)azanide
lithium;azane;bis(trimethylsilyl)azanide (PubChem CID 87657993) has the molecular formula C6H21LiN2Si2
and a molecular weight of 184.36 g/mol. Its IUPAC name is lithium;azane;bis(trimethylsilyl)azanide.
Molecular Properties
| Compound Name | lithium;azane;bis(trimethylsilyl)azanide |
| PubChem CID | 87657993 |
| Molecular Formula | C6H21LiN2Si2 |
| Molecular Weight | 184.36 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | lithium;azane;bis(trimethylsilyl)azanide |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.N.[Li+] |
| InChI | InChI=1S/C6H18NSi2.Li.H3N/c1-8(2,3)7-9(4,5)6;;/h1-6H3;;1H3/q-1;+1; |
| InChIKey | HMBIVRJGCHPRMI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;azane;bis(trimethylsilyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;azane;bis(trimethylsilyl)azanide?
The IUPAC name of lithium;azane;bis(trimethylsilyl)azanide (CID 87657993) is lithium;azane;bis(trimethylsilyl)azanide.
What is the SMILES notation for lithium;azane;bis(trimethylsilyl)azanide?
The canonical SMILES for lithium;azane;bis(trimethylsilyl)azanide is C[Si](C)(C)[N-][Si](C)(C)C.N.[Li+].
What is the InChIKey of lithium;azane;bis(trimethylsilyl)azanide?
The InChIKey is HMBIVRJGCHPRMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18NSi2.Li.H3N/c1-8(2,3)7-9(4,5)6;;/h1-6H3;;1H3/q-1;+1;.
What are the key properties of lithium;azane;bis(trimethylsilyl)azanide?
lithium;azane;bis(trimethylsilyl)azanide has a molecular weight of 184.36 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;azane;bis(trimethylsilyl)azanide is sourced from PubChem (CID 87657993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).