About zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane
zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane (PubChem CID 15799027) has the molecular formula C16H45NSi5Zn
and a molecular weight of 457.36 g/mol. Its IUPAC name is zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane.
Molecular Properties
| Compound Name | zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane |
| PubChem CID | 15799027 |
| Molecular Formula | C16H45NSi5Zn |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane |
| SMILES | C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Zn+2] |
| InChI | InChI=1S/C10H27Si3.C6H18NSi2.Zn/c1-11(2,3)10(12(4,5)6)13(7,8)9;1-8(2,3)7-9(4,5)6;/h1-9H3;1-6H3;/q2*-1;+2 |
| InChIKey | CNDKWHZWUKWUEJ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane?
The IUPAC name of zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane (CID 15799027) is zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane.
What is the SMILES notation for zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane?
The canonical SMILES for zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane is C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Zn+2].
What is the InChIKey of zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane?
The InChIKey is CNDKWHZWUKWUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H27Si3.C6H18NSi2.Zn/c1-11(2,3)10(12(4,5)6)13(7,8)9;1-8(2,3)7-9(4,5)6;/h1-9H3;1-6H3;/q2*-1;+2.
What are the key properties of zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane?
zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane has a molecular weight of 457.36 g/mol, XLogP of 7.22, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis(trimethylsilyl)azanide;bis(trimethylsilyl)methyl-trimethylsilane is sourced from PubChem (CID 15799027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).