C17H14FN3O2 — CID 87659149
3-[1-(3-fluorophenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 87659149) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-[1-(3-fluorophenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[1-(3-fluorophenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 87659149 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[1-(3-fluorophenyl)ethylamino]-4-(pyridin-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CC(Nc1c(Nc2ccncc2)c(=O)c1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H14FN3O2/c1-10(11-3-2-4-12(18)9-11)20-14-15(17(23)16(14)22)21-13-5-7-19-8-6-13/h2-10,20H,1H3,(H,19,21) |
| InChIKey | ZLKKKHPJIXQEJD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|