C23H28N2O3 — CID 143748105
3-[1-(3-acetylphenyl)ethylamino]-4-methylcyclobut-3-ene-1,2-dione;ethane;4-methylpyridine (PubChem CID 143748105) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[1-(3-acetylphenyl)ethylamino]-4-methylcyclobut-3-ene-1,2-dione;ethane;4-methylpyridine.
| Compound Name | 3-[1-(3-acetylphenyl)ethylamino]-4-methylcyclobut-3-ene-1,2-dione;ethane;4-methylpyridine |
|---|---|
| PubChem CID | 143748105 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[1-(3-acetylphenyl)ethylamino]-4-methylcyclobut-3-ene-1,2-dione;ethane;4-methylpyridine |
| SMILES | CC.CC(=O)c1cccc(C(C)Nc2c(C)c(=O)c2=O)c1.Cc1ccncc1 |
| InChI | InChI=1S/C15H15NO3.C6H7N.C2H6/c1-8-13(15(19)14(8)18)16-9(2)11-5-4-6-12(7-11)10(3)17;1-6-2-4-7-5-3-6;1-2/h4-7,9,16H,1-3H3;2-5H,1H3;1-2H3 |
| InChIKey | DFQSJAZGYASVGA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|